C20H18BrClN4O4 — CID 126273086
N'-[(Z)-[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-cyclopropyloxamide (PubChem CID 126273086) has the molecular formula C20H18BrClN4O4 and a molecular weight of 493.75 g/mol. Its IUPAC name is N'-[(Z)-[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-cyclopropyloxamide.
| Compound Name | N'-[(Z)-[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-cyclopropyloxamide |
|---|---|
| PubChem CID | 126273086 |
| Molecular Formula | C20H18BrClN4O4 |
| Molecular Weight | 493.75 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | N'-[(Z)-[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-cyclopropyloxamide |
| SMILES | O=C(COc1ccc(Br)cc1/C=N\NC(=O)C(=O)NC1CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18BrClN4O4/c21-13-1-8-17(30-11-18(27)24-15-4-2-14(22)3-5-15)12(9-13)10-23-26-20(29)19(28)25-16-6-7-16/h1-5,8-10,16H,6-7,11H2,(H,24,27)(H,25,28)(H,26,29)/b23-10- |
| InChIKey | YZZRGNNBYWWKOX-RMORIDSASA-N |
| XLogP | 2.85 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|