C20H18Cl2N4O4 — CID 126267749
N-cyclopropyl-N'-[(Z)-[2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126267749) has the molecular formula C20H18Cl2N4O4 and a molecular weight of 449.29 g/mol. Its IUPAC name is N-cyclopropyl-N'-[(Z)-[2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-cyclopropyl-N'-[(Z)-[2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126267749 |
| Molecular Formula | C20H18Cl2N4O4 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N-cyclopropyl-N'-[(Z)-[2-[2-(3,5-dichloroanilino)-2-oxoethoxy]phenyl]methylideneamino]oxamide |
| SMILES | O=C(COc1ccccc1/C=N\NC(=O)C(=O)NC1CC1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H18Cl2N4O4/c21-13-7-14(22)9-16(8-13)24-18(27)11-30-17-4-2-1-3-12(17)10-23-26-20(29)19(28)25-15-5-6-15/h1-4,7-10,15H,5-6,11H2,(H,24,27)(H,25,28)(H,26,29)/b23-10- |
| InChIKey | DUDUUOJQOZJKMK-RMORIDSASA-N |
| XLogP | 2.74 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|