C16H21N3O3 — CID 94846855
N-cyclopentyl-N'-[(Z)-(2-ethoxyphenyl)methylideneamino]oxamide (PubChem CID 94846855) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-cyclopentyl-N'-[(Z)-(2-ethoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-cyclopentyl-N'-[(Z)-(2-ethoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 94846855 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-cyclopentyl-N'-[(Z)-(2-ethoxyphenyl)methylideneamino]oxamide |
| SMILES | CCOc1ccccc1/C=N\NC(=O)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H21N3O3/c1-2-22-14-10-6-3-7-12(14)11-17-19-16(21)15(20)18-13-8-4-5-9-13/h3,6-7,10-11,13H,2,4-5,8-9H2,1H3,(H,18,20)(H,19,21)/b17-11- |
| InChIKey | JEHNTCALKAMUSG-BOPFTXTBSA-N |
| XLogP | 1.59 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|