C17H21N3O4 — CID 3722549
2-[[[2-(cycloheptylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 3722549) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[[[2-(cycloheptylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-[[[2-(cycloheptylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 3722549 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[[[2-(cycloheptylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(NN=Cc1ccccc1C(=O)O)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C17H21N3O4/c21-15(19-13-8-3-1-2-4-9-13)16(22)20-18-11-12-7-5-6-10-14(12)17(23)24/h5-7,10-11,13H,1-4,8-9H2,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | FKYJAWKLUUCLHB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|