C15H18BrN3O2 — CID 94844327
N'-[(Z)-(4-bromophenyl)methylideneamino]-N-cyclohexyloxamide (PubChem CID 94844327) has the molecular formula C15H18BrN3O2 and a molecular weight of 352.23 g/mol. Its IUPAC name is N'-[(Z)-(4-bromophenyl)methylideneamino]-N-cyclohexyloxamide.
| Compound Name | N'-[(Z)-(4-bromophenyl)methylideneamino]-N-cyclohexyloxamide |
|---|---|
| PubChem CID | 94844327 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | N'-[(Z)-(4-bromophenyl)methylideneamino]-N-cyclohexyloxamide |
| SMILES | O=C(N/N=C\c1ccc(Br)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H18BrN3O2/c16-12-8-6-11(7-9-12)10-17-19-15(21)14(20)18-13-4-2-1-3-5-13/h6-10,13H,1-5H2,(H,18,20)(H,19,21)/b17-10- |
| InChIKey | VZQGRNZZPURPJJ-YVLHZVERSA-N |
| XLogP | 2.35 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|