C14H15N3O4 — CID 8899268
methyl 4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate (PubChem CID 8899268) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is methyl 4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 8899268 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | methyl 4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N\NC(=O)C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C14H15N3O4/c1-21-14(20)10-4-2-9(3-5-10)8-15-17-13(19)12(18)16-11-6-7-11/h2-5,8,11H,6-7H2,1H3,(H,16,18)(H,17,19)/b15-8- |
| InChIKey | GCRMKKZJGWJBPA-NVNXTCNLSA-N |
| XLogP | 0.20 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|