C16H19N5O2 — CID 9043309
N'-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]-N-cyclopropyloxamide (PubChem CID 9043309) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is N'-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]-N-cyclopropyloxamide.
| Compound Name | N'-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]-N-cyclopropyloxamide |
|---|---|
| PubChem CID | 9043309 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N'-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]-N-cyclopropyloxamide |
| SMILES | CN(CCC#N)c1ccc(/C=N\NC(=O)C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C16H19N5O2/c1-21(10-2-9-17)14-7-3-12(4-8-14)11-18-20-16(23)15(22)19-13-5-6-13/h3-4,7-8,11,13H,2,5-6,10H2,1H3,(H,19,22)(H,20,23)/b18-11- |
| InChIKey | ASNBDSVIOTZCAG-WQRHYEAKSA-N |
| XLogP | 0.77 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|