C16H17N5O — CID 9026537
N-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 9026537) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is N-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 9026537 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[(Z)-[4-[2-cyanoethyl(methyl)amino]phenyl]methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | CN(CCC#N)c1ccc(/C=N\NC(=O)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C16H17N5O/c1-21(11-3-9-17)14-7-5-13(6-8-14)12-19-20-16(22)15-4-2-10-18-15/h2,4-8,10,12,18H,3,11H2,1H3,(H,20,22)/b19-12- |
| InChIKey | FWHYRZIFWLNMDG-UNOMPAQXSA-N |
| XLogP | 2.13 |
| TPSA | 84.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|