C15H19N3O2S — CID 5171062
N-cyclopentyl-N'-[(4-methylsulfanylphenyl)methylideneamino]oxamide (PubChem CID 5171062) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-cyclopentyl-N'-[(4-methylsulfanylphenyl)methylideneamino]oxamide.
| Compound Name | N-cyclopentyl-N'-[(4-methylsulfanylphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 5171062 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-cyclopentyl-N'-[(4-methylsulfanylphenyl)methylideneamino]oxamide |
| SMILES | CSc1ccc(C=NNC(=O)C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-21-13-8-6-11(7-9-13)10-16-18-15(20)14(19)17-12-4-2-3-5-12/h6-10,12H,2-5H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | PMHFMUXFIKCBKE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|