C19H27N3O4 — CID 21211563
N-cyclopentyl-N'-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]oxamide (PubChem CID 21211563) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-cyclopentyl-N'-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-cyclopentyl-N'-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 21211563 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-cyclopentyl-N'-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]oxamide |
| SMILES | CCCOc1ccc(/C=N/NC(=O)C(=O)NC2CCCC2)cc1OCC |
| InChI | InChI=1S/C19H27N3O4/c1-3-11-26-16-10-9-14(12-17(16)25-4-2)13-20-22-19(24)18(23)21-15-7-5-6-8-15/h9-10,12-13,15H,3-8,11H2,1-2H3,(H,21,23)(H,22,24)/b20-13+ |
| InChIKey | DPYAXPYNNWPGNC-DEDYPNTBSA-N |
| XLogP | 2.38 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|