C25H33N3O5 — CID 3715828
1-cyclohexyl-3-[[3-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylideneamino]urea (PubChem CID 3715828) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[3-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylideneamino]urea.
| Compound Name | 1-cyclohexyl-3-[[3-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 3715828 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 1-cyclohexyl-3-[[3-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylideneamino]urea |
| SMILES | CCOc1cc(C=NNC(=O)NC2CCCCC2)ccc1OCCOc1ccccc1OC |
| InChI | InChI=1S/C25H33N3O5/c1-3-31-24-17-19(18-26-28-25(29)27-20-9-5-4-6-10-20)13-14-23(24)33-16-15-32-22-12-8-7-11-21(22)30-2/h7-8,11-14,17-18,20H,3-6,9-10,15-16H2,1-2H3,(H2,27,28,29) |
| InChIKey | HNHXYHVIYBFPJR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|