C27H27N3O5 — CID 126205794
(2R)-2-cyano-N-[(Z)-[3-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylideneamino]-2-phenylacetamide (PubChem CID 126205794) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is (2R)-2-cyano-N-[(Z)-[3-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylideneamino]-2-phenylacetamide.
| Compound Name | (2R)-2-cyano-N-[(Z)-[3-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 126205794 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | (2R)-2-cyano-N-[(Z)-[3-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylideneamino]-2-phenylacetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@@H](C#N)c2ccccc2)ccc1OCCOc1ccccc1OC |
| InChI | InChI=1S/C27H27N3O5/c1-3-33-26-17-20(19-29-30-27(31)22(18-28)21-9-5-4-6-10-21)13-14-25(26)35-16-15-34-24-12-8-7-11-23(24)32-2/h4-14,17,19,22H,3,15-16H2,1-2H3,(H,30,31)/b29-19-/t22-/m0/s1 |
| InChIKey | HQUOAFWRARVQFZ-ZZAQJSIPSA-N |
| XLogP | 4.31 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|