C26H22N4O3 — CID 126204131
(2R)-2-cyano-N-[(Z)-[4-[(4-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-phenylacetamide (PubChem CID 126204131) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is (2R)-2-cyano-N-[(Z)-[4-[(4-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-phenylacetamide.
| Compound Name | (2R)-2-cyano-N-[(Z)-[4-[(4-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 126204131 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (2R)-2-cyano-N-[(Z)-[4-[(4-cyanophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-phenylacetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@@H](C#N)c2ccccc2)ccc1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H22N4O3/c1-2-32-25-14-21(12-13-24(25)33-18-20-10-8-19(15-27)9-11-20)17-29-30-26(31)23(16-28)22-6-4-3-5-7-22/h3-14,17,23H,2,18H2,1H3,(H,30,31)/b29-17-/t23-/m0/s1 |
| InChIKey | RQTBMNXOPFSLMR-RSZKVFELSA-N |
| XLogP | 4.29 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|