C23H19N3O2 — CID 126213918
(2S)-2-cyano-2-phenyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 126213918) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is (2S)-2-cyano-2-phenyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | (2S)-2-cyano-2-phenyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126213918 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (2S)-2-cyano-2-phenyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | N#C[C@@H](C(=O)N/N=C\c1ccc(OCc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O2/c24-15-22(20-9-5-2-6-10-20)23(27)26-25-16-18-11-13-21(14-12-18)28-17-19-7-3-1-4-8-19/h1-14,16,22H,17H2,(H,26,27)/b25-16-/t22-/m1/s1 |
| InChIKey | XUCVGWMKPRGVSK-SYANTJLKSA-N |
| XLogP | 4.02 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|