C32H30N4O4 — CID 3730577
N,N'-bis[(4-phenylmethoxyphenyl)methylideneamino]butanediamide (PubChem CID 3730577) has the molecular formula C32H30N4O4 and a molecular weight of 534.62 g/mol. Its IUPAC name is N,N'-bis[(4-phenylmethoxyphenyl)methylideneamino]butanediamide.
| Compound Name | N,N'-bis[(4-phenylmethoxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 3730577 |
| Molecular Formula | C32H30N4O4 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | N,N'-bis[(4-phenylmethoxyphenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)NN=Cc1ccc(OCc2ccccc2)cc1)NN=Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H30N4O4/c37-31(35-33-21-25-11-15-29(16-12-25)39-23-27-7-3-1-4-8-27)19-20-32(38)36-34-22-26-13-17-30(18-14-26)40-24-28-9-5-2-6-10-28/h1-18,21-22H,19-20,23-24H2,(H,35,37)(H,36,38) |
| InChIKey | DCQCVVWVDUKNGO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|