C23H21N3O3 — CID 3990065
N-phenyl-N'-[(4-phenylmethoxyphenyl)methylideneamino]propanediamide (PubChem CID 3990065) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-phenyl-N'-[(4-phenylmethoxyphenyl)methylideneamino]propanediamide.
| Compound Name | N-phenyl-N'-[(4-phenylmethoxyphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 3990065 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-phenyl-N'-[(4-phenylmethoxyphenyl)methylideneamino]propanediamide |
| SMILES | O=C(CC(=O)Nc1ccccc1)NN=Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O3/c27-22(25-20-9-5-2-6-10-20)15-23(28)26-24-16-18-11-13-21(14-12-18)29-17-19-7-3-1-4-8-19/h1-14,16H,15,17H2,(H,25,27)(H,26,28) |
| InChIKey | KZWRRWZKIQHMOH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|