C25H25N3O5 — CID 4317093
N-(3-methoxyphenyl)-N'-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylideneamino]propanediamide (PubChem CID 4317093) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-N'-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylideneamino]propanediamide.
| Compound Name | N-(3-methoxyphenyl)-N'-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylideneamino]propanediamide |
|---|---|
| PubChem CID | 4317093 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-(3-methoxyphenyl)-N'-[[4-[(4-methoxyphenyl)methoxy]phenyl]methylideneamino]propanediamide |
| SMILES | COc1ccc(COc2ccc(C=NNC(=O)CC(=O)Nc3cccc(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C25H25N3O5/c1-31-21-10-8-19(9-11-21)17-33-22-12-6-18(7-13-22)16-26-28-25(30)15-24(29)27-20-4-3-5-23(14-20)32-2/h3-14,16H,15,17H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | SEJCSTRZWBHPET-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|