C29H26N2O4 — CID 4259945
2-(4-phenylmethoxyphenoxy)-N-[(4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 4259945) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-(4-phenylmethoxyphenoxy)-N-[(4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-phenylmethoxyphenoxy)-N-[(4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4259945 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-(4-phenylmethoxyphenoxy)-N-[(4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(OCc2ccccc2)cc1)NN=Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N2O4/c32-29(22-35-28-17-15-27(16-18-28)34-21-25-9-5-2-6-10-25)31-30-19-23-11-13-26(14-12-23)33-20-24-7-3-1-4-8-24/h1-19H,20-22H2,(H,31,32) |
| InChIKey | LKISCDGBBKACNM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|