C33H26N2O5 — CID 3481729
[4-[[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 3481729) has the molecular formula C33H26N2O5 and a molecular weight of 530.58 g/mol. Its IUPAC name is [4-[[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 3481729 |
| Molecular Formula | C33H26N2O5 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | [4-[[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | O=C(COc1ccc(OCc2ccccc2)cc1)NN=Cc1ccc(OC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C33H26N2O5/c36-32(23-39-28-19-17-27(18-20-28)38-22-25-7-2-1-3-8-25)35-34-21-24-13-15-29(16-14-24)40-33(37)31-12-6-10-26-9-4-5-11-30(26)31/h1-21H,22-23H2,(H,35,36) |
| InChIKey | KYDSYVLGCWCDEQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|