C30H22N2O3 — CID 4090058
[4-[[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 4090058) has the molecular formula C30H22N2O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is [4-[[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 4090058 |
| Molecular Formula | C30H22N2O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | [4-[[(2-naphthalen-1-ylacetyl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | O=C(Cc1cccc2ccccc12)NN=Cc1ccc(OC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C30H22N2O3/c33-29(19-24-11-5-9-22-7-1-3-12-26(22)24)32-31-20-21-15-17-25(18-16-21)35-30(34)28-14-6-10-23-8-2-4-13-27(23)28/h1-18,20H,19H2,(H,32,33) |
| InChIKey | RHSFKAIRLGLNNP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|