C27H23N3O5S — CID 6030741
[4-[(Z)-[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 6030741) has the molecular formula C27H23N3O5S and a molecular weight of 501.56 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[(Z)-[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 6030741 |
| Molecular Formula | C27H23N3O5S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | [4-[(Z)-[[2-[(4-methylphenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)N/N=C\c2ccc(OC(=O)c3cccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C27H23N3O5S/c1-19-9-15-23(16-10-19)36(33,34)29-18-26(31)30-28-17-20-11-13-22(14-12-20)35-27(32)25-8-4-6-21-5-2-3-7-24(21)25/h2-17,29H,18H2,1H3,(H,30,31)/b28-17- |
| InChIKey | NAJMOHVXTWROBJ-QRQIAZFYSA-N |
| XLogP | 3.80 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|