C23H20ClN3O5S — CID 6267916
[4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 6267916) has the molecular formula C23H20ClN3O5S and a molecular weight of 485.95 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 6267916 |
| Molecular Formula | C23H20ClN3O5S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | [4-[(Z)-[[2-[(4-chlorophenyl)sulfonylamino]acetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(/C=N\NC(=O)CNS(=O)(=O)c3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H20ClN3O5S/c1-16-2-6-18(7-3-16)23(29)32-20-10-4-17(5-11-20)14-25-27-22(28)15-26-33(30,31)21-12-8-19(24)9-13-21/h2-14,26H,15H2,1H3,(H,27,28)/b25-14- |
| InChIKey | UJBASSGNHPPLHO-QFEZKATASA-N |
| XLogP | 3.30 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|