C22H18FN3O5S — CID 6021477
[4-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate (PubChem CID 6021477) has the molecular formula C22H18FN3O5S and a molecular weight of 455.47 g/mol. Its IUPAC name is [4-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate.
| Compound Name | [4-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 6021477 |
| Molecular Formula | C22H18FN3O5S |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | [4-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)N/N=C\c1ccc(OC(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C22H18FN3O5S/c23-20-9-5-4-8-19(20)22(28)31-17-12-10-16(11-13-17)14-24-26-21(27)15-25-32(29,30)18-6-2-1-3-7-18/h1-14,25H,15H2,(H,26,27)/b24-14- |
| InChIKey | LJMNXRGAUKUFNK-OYKKKHCWSA-N |
| XLogP | 2.47 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|