C24H20FN3O5 — CID 6114048
[4-[(Z)-[[2-[(4-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate (PubChem CID 6114048) has the molecular formula C24H20FN3O5 and a molecular weight of 449.44 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(4-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate.
| Compound Name | [4-[(Z)-[[2-[(4-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 6114048 |
| Molecular Formula | C24H20FN3O5 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [4-[(Z)-[[2-[(4-methoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-fluorobenzoate |
| SMILES | COc1ccc(C(=O)NCC(=O)N/N=C\c2ccc(OC(=O)c3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C24H20FN3O5/c1-32-18-12-8-17(9-13-18)23(30)26-15-22(29)28-27-14-16-6-10-19(11-7-16)33-24(31)20-4-2-3-5-21(20)25/h2-14H,15H2,1H3,(H,26,30)(H,28,29)/b27-14- |
| InChIKey | MTSMCBCPULHFIW-VYYCAZPPSA-N |
| XLogP | 2.93 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|