C26H24BrN3O5 — CID 3350659
[4-[[[2-[(4-propoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate (PubChem CID 3350659) has the molecular formula C26H24BrN3O5 and a molecular weight of 538.40 g/mol. Its IUPAC name is [4-[[[2-[(4-propoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate.
| Compound Name | [4-[[[2-[(4-propoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 3350659 |
| Molecular Formula | C26H24BrN3O5 |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | [4-[[[2-[(4-propoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| SMILES | CCCOc1ccc(C(=O)NCC(=O)NN=Cc2ccc(OC(=O)c3ccccc3Br)cc2)cc1 |
| InChI | InChI=1S/C26H24BrN3O5/c1-2-15-34-20-13-9-19(10-14-20)25(32)28-17-24(31)30-29-16-18-7-11-21(12-8-18)35-26(33)22-5-3-4-6-23(22)27/h3-14,16H,2,15,17H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | RKKCSNLGDZPXIT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|