C27H26BrN3O5 — CID 3717303
[4-bromo-2-[[[2-[(4-propoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate (PubChem CID 3717303) has the molecular formula C27H26BrN3O5 and a molecular weight of 552.43 g/mol. Its IUPAC name is [4-bromo-2-[[[2-[(4-propoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate.
| Compound Name | [4-bromo-2-[[[2-[(4-propoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 3717303 |
| Molecular Formula | C27H26BrN3O5 |
| Molecular Weight | 552.43 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | [4-bromo-2-[[[2-[(4-propoxybenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
| SMILES | CCCOc1ccc(C(=O)NCC(=O)NN=Cc2cc(Br)ccc2OC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C27H26BrN3O5/c1-3-14-35-22-11-8-19(9-12-22)26(33)29-17-25(32)31-30-16-20-15-21(28)10-13-24(20)36-27(34)23-7-5-4-6-18(23)2/h4-13,15-16H,3,14,17H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | RPSTZIALDJRXRS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|