C24H19Br2N3O4 — CID 6012869
[4-bromo-2-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate (PubChem CID 6012869) has the molecular formula C24H19Br2N3O4 and a molecular weight of 573.24 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate.
| Compound Name | [4-bromo-2-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 6012869 |
| Molecular Formula | C24H19Br2N3O4 |
| Molecular Weight | 573.24 g/mol |
| Exact Mass | 570.97 |
| IUPAC Name | [4-bromo-2-[(Z)-[[2-[(3-bromobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1ccc(Br)cc1/C=N\NC(=O)CNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C24H19Br2N3O4/c1-15-5-2-3-8-20(15)24(32)33-21-10-9-19(26)12-17(21)13-28-29-22(30)14-27-23(31)16-6-4-7-18(25)11-16/h2-13H,14H2,1H3,(H,27,31)(H,29,30)/b28-13- |
| InChIKey | ZPIUQJQETWXNRS-QDTIIGTASA-N |
| XLogP | 4.62 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|