C24H21BrN2O5 — CID 5008177
[4-bromo-2-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 2-methylbenzoate (PubChem CID 5008177) has the molecular formula C24H21BrN2O5 and a molecular weight of 497.35 g/mol. Its IUPAC name is [4-bromo-2-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 2-methylbenzoate.
| Compound Name | [4-bromo-2-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 5008177 |
| Molecular Formula | C24H21BrN2O5 |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | [4-bromo-2-[[(3,4-dimethoxybenzoyl)hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
| SMILES | COc1ccc(C(=O)NN=Cc2cc(Br)ccc2OC(=O)c2ccccc2C)cc1OC |
| InChI | InChI=1S/C24H21BrN2O5/c1-15-6-4-5-7-19(15)24(29)32-20-11-9-18(25)12-17(20)14-26-27-23(28)16-8-10-21(30-2)22(13-16)31-3/h4-14H,1-3H3,(H,27,28) |
| InChIKey | RIUBFHIWEYCZDE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|