C23H19BrN2O6 — CID 6018790
[4-bromo-2-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate (PubChem CID 6018790) has the molecular formula C23H19BrN2O6 and a molecular weight of 499.32 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate.
| Compound Name | [4-bromo-2-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 6018790 |
| Molecular Formula | C23H19BrN2O6 |
| Molecular Weight | 499.32 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | [4-bromo-2-[(Z)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]phenyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(Br)cc2/C=N\NC(=O)c2ccccc2O)cc1OC |
| InChI | InChI=1S/C23H19BrN2O6/c1-30-20-9-7-14(12-21(20)31-2)23(29)32-19-10-8-16(24)11-15(19)13-25-26-22(28)17-5-3-4-6-18(17)27/h3-13,27H,1-2H3,(H,26,28)/b25-13- |
| InChIKey | CDSXKNMZBHEAAH-MXAYSNPKSA-N |
| XLogP | 4.16 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|