C22H17BrN2O6 — CID 3807388
[4-bromo-2-[[(2,4-dihydroxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 3807388) has the molecular formula C22H17BrN2O6 and a molecular weight of 485.29 g/mol. Its IUPAC name is [4-bromo-2-[[(2,4-dihydroxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-bromo-2-[[(2,4-dihydroxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 3807388 |
| Molecular Formula | C22H17BrN2O6 |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | [4-bromo-2-[[(2,4-dihydroxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C22H17BrN2O6/c1-30-17-6-2-13(3-7-17)22(29)31-20-9-4-15(23)10-14(20)12-24-25-21(28)18-8-5-16(26)11-19(18)27/h2-12,26-27H,1H3,(H,25,28) |
| InChIKey | SWUVEPDNZXHALJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 117.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|