C25H16BrClN2O4 — CID 6082005
[4-bromo-2-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 6082005) has the molecular formula C25H16BrClN2O4 and a molecular weight of 523.77 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-bromo-2-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6082005 |
| Molecular Formula | C25H16BrClN2O4 |
| Molecular Weight | 523.77 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | [4-bromo-2-[(Z)-[(3-hydroxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(Oc1ccc(Br)cc1/C=N\NC(=O)c1cc2ccccc2cc1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H16BrClN2O4/c26-19-7-10-23(33-25(32)15-5-8-20(27)9-6-15)18(11-19)14-28-29-24(31)21-12-16-3-1-2-4-17(16)13-22(21)30/h1-14,30H,(H,29,31)/b28-14- |
| InChIKey | YSCKSBYOVOLQNO-MUXKCCDJSA-N |
| XLogP | 5.94 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.77 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|