C24H17Br2ClN2O4 — CID 4176873
[4-bromo-2-[[(5-bromo-2-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 4176873) has the molecular formula C24H17Br2ClN2O4 and a molecular weight of 592.67 g/mol. Its IUPAC name is [4-bromo-2-[[(5-bromo-2-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-bromo-2-[[(5-bromo-2-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4176873 |
| Molecular Formula | C24H17Br2ClN2O4 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 589.92 |
| IUPAC Name | [4-bromo-2-[[(5-bromo-2-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | C=CCOc1ccc(Br)cc1C(=O)NN=Cc1cc(Br)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17Br2ClN2O4/c1-2-11-32-22-10-6-18(26)13-20(22)23(30)29-28-14-16-12-17(25)5-9-21(16)33-24(31)15-3-7-19(27)8-4-15/h2-10,12-14H,1,11H2,(H,29,30) |
| InChIKey | AAQOJQVDYQPKMU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|