C28H18BrCl3N2O5 — CID 6063373
[2-[(Z)-[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]-4-bromophenyl] 4-chlorobenzoate (PubChem CID 6063373) has the molecular formula C28H18BrCl3N2O5 and a molecular weight of 648.72 g/mol. Its IUPAC name is [2-[(Z)-[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]-4-bromophenyl] 4-chlorobenzoate.
| Compound Name | [2-[(Z)-[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]-4-bromophenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6063373 |
| Molecular Formula | C28H18BrCl3N2O5 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 645.95 |
| IUPAC Name | [2-[(Z)-[[2,2-bis(4-chlorophenoxy)acetyl]hydrazinylidene]methyl]-4-bromophenyl] 4-chlorobenzoate |
| SMILES | O=C(Oc1ccc(Br)cc1/C=N\NC(=O)C(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H18BrCl3N2O5/c29-19-3-14-25(39-27(36)17-1-4-20(30)5-2-17)18(15-19)16-33-34-26(35)28(37-23-10-6-21(31)7-11-23)38-24-12-8-22(32)9-13-24/h1-16,28H,(H,34,35)/b33-16- |
| InChIKey | OEAFLMGTVBSEER-BJUCDSOZSA-N |
| XLogP | 7.56 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|