C27H20BrClN2O4 — CID 3592949
[4-bromo-2-[(2-naphthalen-2-yloxypropanoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate (PubChem CID 3592949) has the molecular formula C27H20BrClN2O4 and a molecular weight of 551.82 g/mol. Its IUPAC name is [4-bromo-2-[(2-naphthalen-2-yloxypropanoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-bromo-2-[(2-naphthalen-2-yloxypropanoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 3592949 |
| Molecular Formula | C27H20BrClN2O4 |
| Molecular Weight | 551.82 g/mol |
| Exact Mass | 550.03 |
| IUPAC Name | [4-bromo-2-[(2-naphthalen-2-yloxypropanoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
| SMILES | CC(Oc1ccc2ccccc2c1)C(=O)NN=Cc1cc(Br)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20BrClN2O4/c1-17(34-24-12-8-18-4-2-3-5-20(18)15-24)26(32)31-30-16-21-14-22(28)9-13-25(21)35-27(33)19-6-10-23(29)11-7-19/h2-17H,1H3,(H,31,32) |
| InChIKey | CYGLWPHBOZBXRM-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.82 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|