C34H24Cl2N2O6 — CID 3584872
[3-(4-chlorobenzoyl)oxy-4-[(2-naphthalen-2-yloxypropanoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate (PubChem CID 3584872) has the molecular formula C34H24Cl2N2O6 and a molecular weight of 627.48 g/mol. Its IUPAC name is [3-(4-chlorobenzoyl)oxy-4-[(2-naphthalen-2-yloxypropanoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-(4-chlorobenzoyl)oxy-4-[(2-naphthalen-2-yloxypropanoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 3584872 |
| Molecular Formula | C34H24Cl2N2O6 |
| Molecular Weight | 627.48 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | [3-(4-chlorobenzoyl)oxy-4-[(2-naphthalen-2-yloxypropanoylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
| SMILES | CC(Oc1ccc2ccccc2c1)C(=O)NN=Cc1ccc(OC(=O)c2ccc(Cl)cc2)cc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H24Cl2N2O6/c1-21(42-29-16-10-22-4-2-3-5-25(22)18-29)32(39)38-37-20-26-11-17-30(43-33(40)23-6-12-27(35)13-7-23)19-31(26)44-34(41)24-8-14-28(36)15-9-24/h2-21H,1H3,(H,38,39) |
| InChIKey | BSKGVLNQWPBAFA-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.48 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|