C30H21Cl2N3O8 — CID 99694848
[3-(4-chlorobenzoyl)oxy-4-[(Z)-[[(2S)-2-(2-nitrophenoxy)propanoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 99694848) has the molecular formula C30H21Cl2N3O8 and a molecular weight of 622.42 g/mol. Its IUPAC name is [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[(2S)-2-(2-nitrophenoxy)propanoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[(2S)-2-(2-nitrophenoxy)propanoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 99694848 |
| Molecular Formula | C30H21Cl2N3O8 |
| Molecular Weight | 622.42 g/mol |
| Exact Mass | 621.07 |
| IUPAC Name | [3-(4-chlorobenzoyl)oxy-4-[(Z)-[[(2S)-2-(2-nitrophenoxy)propanoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | C[C@H](Oc1ccccc1[N+](=O)[O-])C(=O)N/N=C\c1ccc(OC(=O)c2ccc(Cl)cc2)cc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H21Cl2N3O8/c1-18(41-26-5-3-2-4-25(26)35(39)40)28(36)34-33-17-21-10-15-24(42-29(37)19-6-11-22(31)12-7-19)16-27(21)43-30(38)20-8-13-23(32)14-9-20/h2-18H,1H3,(H,34,36)/b33-17-/t18-/m0/s1 |
| InChIKey | ZUUPFVQINIUVRA-CGWRFCSXSA-N |
| XLogP | 6.26 |
| TPSA | 146.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.42 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|