C25H21BrN2O5 — CID 3425347
[4-[[(5-bromo-2-prop-2-enoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate (PubChem CID 3425347) has the molecular formula C25H21BrN2O5 and a molecular weight of 509.36 g/mol. Its IUPAC name is [4-[[(5-bromo-2-prop-2-enoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate.
| Compound Name | [4-[[(5-bromo-2-prop-2-enoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 3425347 |
| Molecular Formula | C25H21BrN2O5 |
| Molecular Weight | 509.36 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | [4-[[(5-bromo-2-prop-2-enoxybenzoyl)hydrazinylidene]methyl]-2-methoxyphenyl] benzoate |
| SMILES | C=CCOc1ccc(Br)cc1C(=O)NN=Cc1ccc(OC(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C25H21BrN2O5/c1-3-13-32-21-12-10-19(26)15-20(21)24(29)28-27-16-17-9-11-22(23(14-17)31-2)33-25(30)18-7-5-4-6-8-18/h3-12,14-16H,1,13H2,2H3,(H,28,29) |
| InChIKey | XFVGSVQUFJZWAP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|