C18H17BrN2O4 — CID 3656361
5-bromo-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-prop-2-enoxybenzamide (PubChem CID 3656361) has the molecular formula C18H17BrN2O4 and a molecular weight of 405.25 g/mol. Its IUPAC name is 5-bromo-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-prop-2-enoxybenzamide.
| Compound Name | 5-bromo-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 3656361 |
| Molecular Formula | C18H17BrN2O4 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 5-bromo-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]-2-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(Br)cc1C(=O)NN=Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C18H17BrN2O4/c1-3-8-25-16-7-5-13(19)10-14(16)18(23)21-20-11-12-4-6-15(22)17(9-12)24-2/h3-7,9-11,22H,1,8H2,2H3,(H,21,23) |
| InChIKey | HSOIGEFETMQZGK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|