C24H22BrN3O6 — CID 126072144
5-bromo-2-hydroxy-N-[(Z)-[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126072144) has the molecular formula C24H22BrN3O6 and a molecular weight of 528.36 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-[(Z)-[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-[(Z)-[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126072144 |
| Molecular Formula | C24H22BrN3O6 |
| Molecular Weight | 528.36 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 5-bromo-2-hydroxy-N-[(Z)-[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(/C=N\NC(=O)c2cc(Br)ccc2O)cc1OC |
| InChI | InChI=1S/C24H22BrN3O6/c1-32-20-6-4-3-5-18(20)27-23(30)14-34-21-10-7-15(11-22(21)33-2)13-26-28-24(31)17-12-16(25)8-9-19(17)29/h3-13,29H,14H2,1-2H3,(H,27,30)(H,28,31)/b26-13- |
| InChIKey | UACJGJDSTQAPGF-ZMFRSBBQSA-N |
| XLogP | 3.95 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|