C23H22N4O5 — CID 1276215
N-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]pyridine-3-carboxamide (PubChem CID 1276215) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is N-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 1276215 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[[3-methoxy-4-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]pyridine-3-carboxamide |
| SMILES | COc1ccccc1NC(=O)COc1ccc(C=NNC(=O)c2cccnc2)cc1OC |
| InChI | InChI=1S/C23H22N4O5/c1-30-19-8-4-3-7-18(19)26-22(28)15-32-20-10-9-16(12-21(20)31-2)13-25-27-23(29)17-6-5-11-24-14-17/h3-14H,15H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | KBUNOZFAKBXSAM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|