C25H25N3O5 — CID 126015220
4-methoxy-N-[(E)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126015220) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 4-methoxy-N-[(E)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-methoxy-N-[(E)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126015220 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-methoxy-N-[(E)-[3-methoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C/c2ccc(OCC(=O)Nc3ccccc3C)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H25N3O5/c1-17-6-4-5-7-21(17)27-24(29)16-33-22-13-8-18(14-23(22)32-3)15-26-28-25(30)19-9-11-20(31-2)12-10-19/h4-15H,16H2,1-3H3,(H,27,29)(H,28,30)/b26-15+ |
| InChIKey | YXYRZDOOWXEPQX-CVKSISIWSA-N |
| XLogP | 3.79 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|