C27H29N3O6 — CID 126018675
N-[(E)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-methoxyphenoxy)acetamide (PubChem CID 126018675) has the molecular formula C27H29N3O6 and a molecular weight of 491.54 g/mol. Its IUPAC name is N-[(E)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[(E)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 126018675 |
| Molecular Formula | C27H29N3O6 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-[(E)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]-2-(4-methoxyphenoxy)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)COc2ccc(OC)cc2)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C27H29N3O6/c1-4-34-25-15-20(16-28-30-27(32)18-35-22-12-10-21(33-3)11-13-22)9-14-24(25)36-17-26(31)29-23-8-6-5-7-19(23)2/h5-16H,4,17-18H2,1-3H3,(H,29,31)(H,30,32)/b28-16+ |
| InChIKey | ITLIHRRCJNBCTD-LQKURTRISA-N |
| XLogP | 3.95 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|