C26H26ClN3O5 — CID 126016728
2-(4-chlorophenoxy)-N-[(Z)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide (PubChem CID 126016728) has the molecular formula C26H26ClN3O5 and a molecular weight of 495.96 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(Z)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(Z)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126016728 |
| Molecular Formula | C26H26ClN3O5 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(Z)-[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)COc2ccc(Cl)cc2)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C26H26ClN3O5/c1-3-33-24-14-19(15-28-30-26(32)17-34-21-11-9-20(27)10-12-21)8-13-23(24)35-16-25(31)29-22-7-5-4-6-18(22)2/h4-15H,3,16-17H2,1-2H3,(H,29,31)(H,30,32)/b28-15- |
| InChIKey | DNWSOTVYBBMJFK-MBTHVWNTSA-N |
| XLogP | 4.59 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|