C30H27ClN2O4 — CID 45054791
N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-phenylphenoxy)acetamide (PubChem CID 45054791) has the molecular formula C30H27ClN2O4 and a molecular weight of 515.01 g/mol. Its IUPAC name is N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 45054791 |
| Molecular Formula | C30H27ClN2O4 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | N-[(E)-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(4-phenylphenoxy)acetamide |
| SMILES | CCOc1cc(/C=N/NC(=O)COc2ccc(-c3ccccc3)cc2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H27ClN2O4/c1-2-35-29-18-23(10-17-28(29)37-20-22-8-13-26(31)14-9-22)19-32-33-30(34)21-36-27-15-11-25(12-16-27)24-6-4-3-5-7-24/h3-19H,2,20-21H2,1H3,(H,33,34)/b32-19+ |
| InChIKey | POBGBZVMNMLWMX-BIZUNTBRSA-N |
| XLogP | 6.51 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|