C24H22Cl2N2O4 — CID 3470692
2-(2,5-dichlorophenoxy)-N-[(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 3470692) has the molecular formula C24H22Cl2N2O4 and a molecular weight of 473.36 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3470692 |
| Molecular Formula | C24H22Cl2N2O4 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(C=NNC(=O)COc2cc(Cl)ccc2Cl)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H22Cl2N2O4/c1-2-30-23-12-18(8-11-21(23)31-15-17-6-4-3-5-7-17)14-27-28-24(29)16-32-22-13-19(25)9-10-20(22)26/h3-14H,2,15-16H2,1H3,(H,28,29) |
| InChIKey | JQVPDUIGBNDFTP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|