C27H27Cl2N3O4 — CID 3428879
N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)butanediamide (PubChem CID 3428879) has the molecular formula C27H27Cl2N3O4 and a molecular weight of 528.44 g/mol. Its IUPAC name is N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)butanediamide.
| Compound Name | N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 3428879 |
| Molecular Formula | C27H27Cl2N3O4 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)butanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CCC(=O)Nc2ccccc2C)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H27Cl2N3O4/c1-3-35-25-14-19(8-11-24(25)36-17-20-9-10-21(28)15-22(20)29)16-30-32-27(34)13-12-26(33)31-23-7-5-4-6-18(23)2/h4-11,14-16H,3,12-13,17H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | OWBSMDIEVZVPEU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|