C27H28BrN3O4 — CID 3656589
N'-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)butanediamide (PubChem CID 3656589) has the molecular formula C27H28BrN3O4 and a molecular weight of 538.44 g/mol. Its IUPAC name is N'-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)butanediamide.
| Compound Name | N'-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 3656589 |
| Molecular Formula | C27H28BrN3O4 |
| Molecular Weight | 538.44 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | N'-[[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)butanediamide |
| SMILES | CCOc1cc(C=NNC(=O)CCC(=O)Nc2ccccc2C)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C27H28BrN3O4/c1-3-34-25-16-21(10-13-24(25)35-18-20-8-11-22(28)12-9-20)17-29-31-27(33)15-14-26(32)30-23-7-5-4-6-19(23)2/h4-13,16-17H,3,14-15,18H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | CKIDRRXOMYWAIH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|