C25H27N3O3 — CID 5092049
1-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 5092049) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 5092049 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 1-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | CCOc1cc(C=NNC(=O)Nc2ccccc2C)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-4-30-24-15-20(12-13-23(24)31-17-21-10-7-8-18(2)14-21)16-26-28-25(29)27-22-11-6-5-9-19(22)3/h5-16H,4,17H2,1-3H3,(H2,27,28,29) |
| InChIKey | UYRKGBXFVXOKBR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|