C24H24IN3O3 — CID 5032044
1-[[3-iodo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 5032044) has the molecular formula C24H24IN3O3 and a molecular weight of 529.38 g/mol. Its IUPAC name is 1-[[3-iodo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[3-iodo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 5032044 |
| Molecular Formula | C24H24IN3O3 |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | 1-[[3-iodo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | COc1cc(C=NNC(=O)Nc2ccccc2C)cc(I)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C24H24IN3O3/c1-16-7-6-9-18(11-16)15-31-23-20(25)12-19(13-22(23)30-3)14-26-28-24(29)27-21-10-5-4-8-17(21)2/h4-14H,15H2,1-3H3,(H2,27,28,29) |
| InChIKey | XZXMKIRZHRSWES-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|