C27H24BrN3O3 — CID 4020474
1-[[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 4020474) has the molecular formula C27H24BrN3O3 and a molecular weight of 518.41 g/mol. Its IUPAC name is 1-[[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 4020474 |
| Molecular Formula | C27H24BrN3O3 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 1-[[3-bromo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | COc1cc(C=NNC(=O)Nc2ccccc2C)cc(Br)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H24BrN3O3/c1-18-7-3-6-10-24(18)30-27(32)31-29-16-20-14-23(28)26(25(15-20)33-2)34-17-19-11-12-21-8-4-5-9-22(21)13-19/h3-16H,17H2,1-2H3,(H2,30,31,32) |
| InChIKey | WYUVFNCKQPMURT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|